![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| tues.pptx | 2024-10-02 19:15 | 51K | |
| tues - sentences and paragraphs.pdf | 2024-10-02 19:15 | 110K | |
| tues - marked up.pptx | 2024-10-02 19:15 | 53K | |
| short examples.txt | 2024-10-02 19:15 | 2.0K | |
| sense of structure.ppt | 2024-10-02 19:15 | 403K | |
| science-for-scientific-writing-handout.original.pdf | 2024-10-02 19:15 | 376K | |
| sample text/ | 2024-10-02 19:15 | - | |
| possible paper for Thursday.pdf | 2024-10-02 19:15 | 3.0M | |
| gopenswanrev.ppt | 2024-10-02 19:15 | 207K | |
| gopen-swan-1990.pdf | 2024-10-02 19:15 | 34K | |
| bad and good/ | 2024-10-02 19:15 | - | |
| Gopen on paragraphs.pdf | 2024-10-02 19:15 | 3.0M | |
| Discussion of article by Gopen & Swan.pdf | 2024-10-02 19:15 | 4.7M | |
| 50YearsDataScience.pdf | 2024-10-02 19:15 | 424K | |
| 01 tues plan.txt | 2024-10-02 19:15 | 2.7K | |